cas: 1363381-18-3 — see every product listed under this CAS number, including other names
2-(TERT-BUTOXYCARBONYL)-2-AZASPIRO[3.5]NONANE-7-CARBOXYLIC ACID, 97% (CAS 1363381-18-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F388146-100MG |
| cas | 1363381-18-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 659.16 Pln | |
| Fluorochem | 250mg | 1034.03 Pln | |
| Fluorochem | 500mg | 1736.91 Pln | |
| Fluorochem | 1g | 2611.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azaspiro[3.5]nonane-7-carboxylic acid (CAS 1363381-18-3) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azaspiro[3.5]nonane-7-carboxylic acid. InChIKey: CGBNTOUUTCHHQO-UHFFFAOYSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azaspiro[3.5]nonane-7-carboxylic acid |
| InChIKey | CGBNTOUUTCHHQO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CCC(CC2)C(=O)O |
Computed by PubChem (NCBI)