cas: 1067881-40-6 — see every product listed under this CAS number, including other names
2-(TERT-BUTOXYCARBONYLAMINO)-3-CYCLOOCTYL-PROPANOIC ACID, 97% (CAS 1067881-40-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F834915-100MG |
| cas | 1067881-40-6 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1336.01 Pln | |
| Fluorochem | 250mg | 1736.91 Pln | |
| Fluorochem | 500mg | 2851.10 Pln | |
| Fluorochem | 1g | 4183.96 Pln | |
| Fluorochem | 5g | 12160.32 Pln | |
| Chemat | 100mg | 731.60 Pln | |
| Chemat | 250mg | 952.40 Pln | |
| Chemat | 500mg | 1542.80 Pln | |
| Chemat | 1g | 2282.00 Pln | |
| Chemat | 5g | 6726.80 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
3-cyclooctyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1067881-40-6) is a chemical compound with the molecular formula C16H29NO4 and a molecular weight of 299.41 g/mol. IUPAC name: 3-cyclooctyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: YCDKRFRIIKNPNR-UHFFFAOYSA-N.
| Molecular formula | C16H29NO4 |
|---|---|
| Molecular weight | 299.41 g/mol |
| IUPAC name | 3-cyclooctyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | YCDKRFRIIKNPNR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1CCCCCCC1)C(=O)O |
Computed by PubChem (NCBI)