cas: 2102410-34-2 — see every product listed under this CAS number, including other names
2-(Tert-butyl) 5-ethyl 2,7-diazaspiro[3.5]Nonane-2,5-dicarboxylate, 95%, 95% (CAS 2102410-34-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1333AV-100mg |
| cas | 2102410-34-2 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2018.00 Pln | |
| Chemat | 250mg | 3602.00 Pln | |
| Chemat | 1g | 9760.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-O-tert-butyl 5-O-ethyl 2,7-diazaspiro[3.5]nonane-2,5-dicarboxylate (CAS 2102410-34-2) is a chemical compound with the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. IUPAC name: 2-O-tert-butyl 5-O-ethyl 2,7-diazaspiro[3.5]nonane-2,5-dicarboxylate. InChIKey: WVVJCSWSUQMJTO-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O4 |
|---|---|
| Molecular weight | 298.38 g/mol |
| IUPAC name | 2-O-tert-butyl 5-O-ethyl 2,7-diazaspiro[3.5]nonane-2,5-dicarboxylate |
| InChIKey | WVVJCSWSUQMJTO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CNCCC12CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)