cas: 103008-51-1 — see every product listed under this CAS number, including other names
2-(Trifluoromethoxy)benzenesulfonyl chloride (CAS 103008-51-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007539-1G |
| cas | 103008-51-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 190.58 Pln | |
| Fluorochem | 25g | 268.67 Pln | |
| Fluorochem | 100g | 633.13 Pln |
| delivery time | 3-4 weeks |
|---|
2-(trifluoromethoxy)benzenesulfonyl chloride (CAS 103008-51-1) is a chemical compound with the molecular formula C7H4ClF3O3S and a molecular weight of 260.62 g/mol. IUPAC name: 2-(trifluoromethoxy)benzenesulfonyl chloride. InChIKey: JLTBWYIUMFEOTN-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O3S |
|---|---|
| Molecular weight | 260.62 g/mol |
| IUPAC name | 2-(trifluoromethoxy)benzenesulfonyl chloride |
| InChIKey | JLTBWYIUMFEOTN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)