CAS 1644-79-7 is the registry number for 4-Chloro-3-(trifluoromethyl)benzenesulfonic acid, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 100mg.
4-chloro-3-(trifluoromethyl)benzenesulfonic acid (CAS 1644-79-7) is a chemical compound with the molecular formula C7H4ClF3O3S and a molecular weight of 260.62 g/mol. IUPAC name: 4-chloro-3-(trifluoromethyl)benzenesulfonic acid. InChIKey: SUQWINLDJOTVAP-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O3S |
|---|---|
| Molecular weight | 260.62 g/mol |
| IUPAC name | 4-chloro-3-(trifluoromethyl)benzenesulfonic acid |
| InChIKey | SUQWINLDJOTVAP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)