Products 1644-79-7

CAS 1644-79-7 is the registry number for 4-Chloro-3-(trifluoromethyl)benzenesulfonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-chloro-3-(trifluoromethyl)benzenesulfonic acid (CAS 1644-79-7) is a chemical compound with the molecular formula C7H4ClF3O3S and a molecular weight of 260.62 g/mol. IUPAC name: 4-chloro-3-(trifluoromethyl)benzenesulfonic acid. InChIKey: SUQWINLDJOTVAP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4ClF3O3S
Molecular weight260.62 g/mol
IUPAC name4-chloro-3-(trifluoromethyl)benzenesulfonic acid
InChIKeySUQWINLDJOTVAP-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1S(=O)(=O)O)C(F)(F)F)Cl

Computed by PubChem (NCBI)