CAS 103008-51-1 appears in our catalog under these names: 2-(Trifluoromethoxy)benzene-1-sulfonyl chloride, 97% , 2-(Trifluoromethoxy)benzene-1-sulfonyl chloride 98%, 2-(Trifluoromethoxy)benzenesulfonyl chloride, 98%, 2–(Trifluoromethoxy)benzenesulfonyl chloride, 2-(Trifluoromethoxy)benzenesulfonyl chloride. Offered by: Thermo Scientific, Ambeed, Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 1kg, 500g, 10g.
2-(trifluoromethoxy)benzenesulfonyl chloride (CAS 103008-51-1) is a chemical compound with the molecular formula C7H4ClF3O3S and a molecular weight of 260.62 g/mol. IUPAC name: 2-(trifluoromethoxy)benzenesulfonyl chloride. InChIKey: JLTBWYIUMFEOTN-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O3S |
|---|---|
| Molecular weight | 260.62 g/mol |
| IUPAC name | 2-(trifluoromethoxy)benzenesulfonyl chloride |
| InChIKey | JLTBWYIUMFEOTN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)