CAS 383-11-9 appears in our catalog under these names: 1-Chloro-4-((trifluoromethyl)sulfonyl)benzene, 95+%, 1-chloro-4-trifluoromethanesulfonylbenzene, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 50mg, 100mg, 250mg.
1-chloro-4-(trifluoromethylsulfonyl)benzene (CAS 383-11-9) is a chemical compound with the molecular formula C7H4ClF3O2S and a molecular weight of 244.62 g/mol. IUPAC name: 1-chloro-4-(trifluoromethylsulfonyl)benzene. InChIKey: PVPZMAOFUOXVHI-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O2S |
|---|---|
| Molecular weight | 244.62 g/mol |
| IUPAC name | 1-chloro-4-(trifluoromethylsulfonyl)benzene |
| InChIKey | PVPZMAOFUOXVHI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)