Products 1228781-84-7
CAS 1228781-84-7 is the registry number for 1-Chlorodifluoromethanesulfonyl-2-fluorobenzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[chloro(difluoro)methyl]sulfonyl-2-fluorobenzene (CAS 1228781-84-7) is a chemical compound with the molecular formula C7H4ClF3O2S and a molecular weight of 244.62 g/mol. IUPAC name: 1-[chloro(difluoro)methyl]sulfonyl-2-fluorobenzene. InChIKey: VPNVIICBRVNXKW-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O2S |
|---|---|
| Molecular weight | 244.62 g/mol |
| IUPAC name | 1-[chloro(difluoro)methyl]sulfonyl-2-fluorobenzene |
| InChIKey | VPNVIICBRVNXKW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)F)S(=O)(=O)C(F)(F)Cl |
Computed by PubChem (NCBI)