cas: 3038-47-9 — see every product listed under this CAS number, including other names
2-(Trifluoromethyl)phenylacetonitrile, ≥98%, ≥98% (CAS 3038-47-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113ZXI-1g |
| cas | 3038-47-9 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 194.00 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
2-[2-(trifluoromethyl)phenyl]acetonitrile (CAS 3038-47-9) is a chemical compound with the molecular formula C9H6F3N and a molecular weight of 185.15 g/mol. IUPAC name: 2-[2-(trifluoromethyl)phenyl]acetonitrile. InChIKey: QXDCZSJGEUSERL-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 2-[2-(trifluoromethyl)phenyl]acetonitrile |
| InChIKey | QXDCZSJGEUSERL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC#N)C(F)(F)F |
Computed by PubChem (NCBI)