CAS 163975-04-0 is the registry number for 3-(2,2,2-Trifluoroethyl)benzonitrile, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
3-(2,2,2-trifluoroethyl)benzonitrile (CAS 163975-04-0) is a chemical compound with the molecular formula C9H6F3N and a molecular weight of 185.15 g/mol. IUPAC name: 3-(2,2,2-trifluoroethyl)benzonitrile. InChIKey: XZPHPNWCYCJPQF-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethyl)benzonitrile |
| InChIKey | XZPHPNWCYCJPQF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C#N)CC(F)(F)F |
Computed by PubChem (NCBI)