cas: 1464091-60-8 — see every product listed under this CAS number, including other names
2-(Trifluoromethyl)quinolin-3-amine, 98%, 98% (CAS 1464091-60-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112DZE-100mg |
| cas | 1464091-60-8 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1278.80 Pln | |
| Chemat | 250mg | 1888.40 Pln | |
| Chemat | 500mg | 3261.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(trifluoromethyl)quinolin-3-amine (CAS 1464091-60-8) is a chemical compound with the molecular formula C10H7F3N2 and a molecular weight of 212.17 g/mol. IUPAC name: 2-(trifluoromethyl)quinolin-3-amine. InChIKey: OGKZZXVXLZCMQW-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | 2-(trifluoromethyl)quinolin-3-amine |
| InChIKey | OGKZZXVXLZCMQW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=N2)C(F)(F)F)N |
Computed by PubChem (NCBI)