Products 35715-68-5
CAS 35715-68-5 appears in our catalog under these names: 1-[3-(Trifluoromethyl)phenyl]pyrazole, 96%, 1-(3-(Trifluoromethyl)phenyl)-1H-pyrazole. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
1-[3-(trifluoromethyl)phenyl]pyrazole (CAS 35715-68-5) is a chemical compound with the molecular formula C10H7F3N2 and a molecular weight of 212.17 g/mol. IUPAC name: 1-[3-(trifluoromethyl)phenyl]pyrazole. InChIKey: AWYVWLRVIUZBQI-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | 1-[3-(trifluoromethyl)phenyl]pyrazole |
| InChIKey | AWYVWLRVIUZBQI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C=CC=N2)C(F)(F)F |
Computed by PubChem (NCBI)