cas: 238403-52-6 — see every product listed under this CAS number, including other names
2-(Trifluoromethylthio)benzyl bromide, 98% (CAS 238403-52-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F008010-100MG |
| cas | 238403-52-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 227.02 Pln | |
| Fluorochem | 250mg | 414.46 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(bromomethyl)-2-(trifluoromethylsulfanyl)benzene (CAS 238403-52-6) is a chemical compound with the molecular formula C8H6BrF3S and a molecular weight of 271.10 g/mol. IUPAC name: 1-(bromomethyl)-2-(trifluoromethylsulfanyl)benzene. InChIKey: ZSBCQBRVNBLWAW-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3S |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | 1-(bromomethyl)-2-(trifluoromethylsulfanyl)benzene |
| InChIKey | ZSBCQBRVNBLWAW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CBr)SC(F)(F)F |
Computed by PubChem (NCBI)