CAS 300356-31-4 appears in our catalog under these names: 4-Bromo-2-(trifluoromethyl)thioanisole, 95%, 4-Bromo-1-(methylthio)-2-(trifluoromethyl)-benzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 100g, 5g, 1g.
4-bromo-1-methylsulfanyl-2-(trifluoromethyl)benzene (CAS 300356-31-4) is a chemical compound with the molecular formula C8H6BrF3S and a molecular weight of 271.10 g/mol. IUPAC name: 4-bromo-1-methylsulfanyl-2-(trifluoromethyl)benzene. InChIKey: KMADDVSNZFTXEC-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3S |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | 4-bromo-1-methylsulfanyl-2-(trifluoromethyl)benzene |
| InChIKey | KMADDVSNZFTXEC-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=C(C=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)