CAS 213203-84-0 appears in our catalog under these names: 3-(Trifluoromethylthio)benzyl bromide, 95%, (3-(Bromomethyl)phenyl)(trifluoromethyl)sulfane, 97%, 3-(Trifluoromethylthio)benzyl bromide. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 25g.
1-(bromomethyl)-3-(trifluoromethylsulfanyl)benzene (CAS 213203-84-0) is a chemical compound with the molecular formula C8H6BrF3S and a molecular weight of 271.10 g/mol. IUPAC name: 1-(bromomethyl)-3-(trifluoromethylsulfanyl)benzene. InChIKey: MPZVFRHSCOOMNG-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3S |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | 1-(bromomethyl)-3-(trifluoromethylsulfanyl)benzene |
| InChIKey | MPZVFRHSCOOMNG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)SC(F)(F)F)CBr |
Computed by PubChem (NCBI)