cas: 1311183-31-9 — see every product listed under this CAS number, including other names
2-(cyclopropylmethoxy)-5-methylphenylboronic acid, 97% (CAS 1311183-31-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F623023-5G |
| cas | 1311183-31-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 12071.81 Pln | |
| Fluorochem | 100mg | 1060.06 Pln | |
| Fluorochem | 250mg | 1632.78 Pln | |
| Fluorochem | 1g | 4064.21 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[2-(cyclopropylmethoxy)-5-methylphenyl]boronic acid (CAS 1311183-31-9) is a chemical compound with the molecular formula C11H15BO3 and a molecular weight of 206.05 g/mol. IUPAC name: [2-(cyclopropylmethoxy)-5-methylphenyl]boronic acid. InChIKey: HDCXPITXWUSFAB-UHFFFAOYSA-N.
| Molecular formula | C11H15BO3 |
|---|---|
| Molecular weight | 206.05 g/mol |
| IUPAC name | [2-(cyclopropylmethoxy)-5-methylphenyl]boronic acid |
| InChIKey | HDCXPITXWUSFAB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C)OCC2CC2)(O)O |
Computed by PubChem (NCBI)