cas: 84682-22-4 — see every product listed under this CAS number, including other names
2-(pyridin-2-yl)-1,3-thiazolidine-4-carboxylic acid, 98%, 98% (CAS 84682-22-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G8IA-100mg |
| cas | 84682-22-4 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 1010.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-pyridin-2-yl-1,3-thiazolidine-4-carboxylic acid (CAS 84682-22-4) is a chemical compound with the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. IUPAC name: 2-pyridin-2-yl-1,3-thiazolidine-4-carboxylic acid. InChIKey: FRABGDHEKOTVGC-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2S |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | 2-pyridin-2-yl-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | FRABGDHEKOTVGC-UHFFFAOYSA-N |
| SMILES | C1C(NC(S1)C2=CC=CC=N2)C(=O)O |
Computed by PubChem (NCBI)