CAS 74004-74-3 is the registry number for 5,6-Dimethoxy-1h-benzimidazole-2-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5,6-dimethoxy-1,3-dihydrobenzimidazole-2-thione (CAS 74004-74-3) is a chemical compound with the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. IUPAC name: 5,6-dimethoxy-1,3-dihydrobenzimidazole-2-thione. InChIKey: AIPIIYXJGWHOHR-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2S |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | 5,6-dimethoxy-1,3-dihydrobenzimidazole-2-thione |
| InChIKey | AIPIIYXJGWHOHR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)NC(=S)N2)OC |
Computed by PubChem (NCBI)