CAS 65948-18-7 is the registry number for 4,6-Dimethoxy-1,3-benzothiazol-2-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g.
4,6-dimethoxy-1,3-benzothiazol-2-amine (CAS 65948-18-7) is a chemical compound with the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. IUPAC name: 4,6-dimethoxy-1,3-benzothiazol-2-amine. InChIKey: QAOYBHURRQZAGR-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2S |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | 4,6-dimethoxy-1,3-benzothiazol-2-amine |
| InChIKey | QAOYBHURRQZAGR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=C1)SC(=N2)N)OC |
Computed by PubChem (NCBI)