cas: 1251009-59-2 — see every product listed under this CAS number, including other names
2-(tert-Butoxycarbonyl)-7-oxa-2-azaspiro[3.5]nonane-5-carboxylic acid, 95+% (CAS 1251009-59-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 10mg, 25mg, 50mg, 1g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F601715-100MG |
| cas | 1251009-59-2 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 4491.14 Pln | |
| Fluorochem | 250mg | 7859.75 Pln | |
| Ambeed | 10mg | 642.94 Pln | |
| Ambeed | 25mg | 1149.12 Pln | |
| Ambeed | 50mg | 1900.06 Pln | |
| Ambeed | 100mg | 3179.44 Pln | |
| Ambeed | 250mg | 6105.31 Pln | |
| Ambeed | 1g | 12151.75 Pln |
| purity | 95+% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2-[(2-methylpropan-2-yl)oxycarbonyl]-7-oxa-2-azaspiro[3.5]nonane-5-carboxylic acid (CAS 1251009-59-2) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonyl]-7-oxa-2-azaspiro[3.5]nonane-5-carboxylic acid. InChIKey: HTJUFOVAKKEPJG-UHFFFAOYSA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonyl]-7-oxa-2-azaspiro[3.5]nonane-5-carboxylic acid |
| InChIKey | HTJUFOVAKKEPJG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CCOCC2C(=O)O |
Computed by PubChem (NCBI)