2-(tert-Butyl) 3-methyl 2,8-diazaspiro[4.5]decane-2,3-dicarboxylate, 95%
cas: 2388515-35-1 — see every product listed under this CAS number, including other names
2-(tert-Butyl) 3-methyl 2,8-diazaspiro[4.5]decane-2,3-dicarboxylate, 95% (CAS 2388515-35-1) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2315238-10mg |
| cas | 2388515-35-1 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 464.94 Pln | |
| Ambeed | 25mg | 820.94 Pln | |
| Ambeed | 50mg | 1338.25 Pln | |
| Ambeed | 100mg | 2228.25 Pln | |
| Ambeed | 250mg | 3952.62 Pln | |
| Ambeed | 1g | 12507.75 Pln | |
| BLDpharm | 10mg | 497.63 Pln | |
| BLDpharm | 25mg | 880.83 Pln | |
| BLDpharm | 50mg | 1441.74 Pln | |
| BLDpharm | 100mg | 2396.96 Pln | |
| BLDpharm | 250mg | 4257.41 Pln | |
| BLDpharm | 1g | 13476.39 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-O-tert-butyl 3-O-methyl 2,8-diazaspiro[4.5]decane-2,3-dicarboxylate (CAS 2388515-35-1) is a chemical compound with the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. IUPAC name: 2-O-tert-butyl 3-O-methyl 2,8-diazaspiro[4.5]decane-2,3-dicarboxylate. InChIKey: XPSMIHKWWFXKMB-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O4 |
|---|---|
| Molecular weight | 298.38 g/mol |
| IUPAC name | 2-O-tert-butyl 3-O-methyl 2,8-diazaspiro[4.5]decane-2,3-dicarboxylate |
| InChIKey | XPSMIHKWWFXKMB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCNCC2)CC1C(=O)OC |
Computed by PubChem (NCBI)