cas: 3896-11-5 — see every product listed under this CAS number, including other names
2-(tert-Butyl)-6-(5-chloro-2H-benzo[d][1,2,3]triazol-2-yl)-4-methylphenol 97% (CAS 3896-11-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A150618-25g |
| cas | 3896-11-5 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 242.44 Pln | |
| Ambeed | 500g | 598.44 Pln | |
| Ambeed | 1000g | 971.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A150618 |
2-tert-butyl-6-(5-chlorobenzotriazol-2-yl)-4-methylphenol (CAS 3896-11-5) is a chemical compound with the molecular formula C17H18ClN3O and a molecular weight of 315.8 g/mol. IUPAC name: 2-tert-butyl-6-(5-chlorobenzotriazol-2-yl)-4-methylphenol. InChIKey: OCWYEMOEOGEQAN-UHFFFAOYSA-N.
| Molecular formula | C17H18ClN3O |
|---|---|
| Molecular weight | 315.8 g/mol |
| IUPAC name | 2-tert-butyl-6-(5-chlorobenzotriazol-2-yl)-4-methylphenol |
| InChIKey | OCWYEMOEOGEQAN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)N2N=C3C=CC(=CC3=N2)Cl)O)C(C)(C)C |
Computed by PubChem (NCBI)