cas: 3896-11-5 — see every product listed under this CAS number, including other names
2-(tert-Butyl)-6-(5-chloro-2H-benzo[d][1,2,3]triazol-2-yl)-4-methylphenol, 97%, 97% (CAS 3896-11-5) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 10g, 25g, 50g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114EXZ-1kg |
| cas | 3896-11-5 |
| size | 1kg |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 693.20 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 50g | 102.80 Pln | |
| Chemat | 100g | 141.20 Pln | |
| Chemat | 500g | 403.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-tert-butyl-6-(5-chlorobenzotriazol-2-yl)-4-methylphenol (CAS 3896-11-5) is a chemical compound with the molecular formula C17H18ClN3O and a molecular weight of 315.8 g/mol. IUPAC name: 2-tert-butyl-6-(5-chlorobenzotriazol-2-yl)-4-methylphenol. InChIKey: OCWYEMOEOGEQAN-UHFFFAOYSA-N.
| Molecular formula | C17H18ClN3O |
|---|---|
| Molecular weight | 315.8 g/mol |
| IUPAC name | 2-tert-butyl-6-(5-chlorobenzotriazol-2-yl)-4-methylphenol |
| InChIKey | OCWYEMOEOGEQAN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)N2N=C3C=CC(=CC3=N2)Cl)O)C(C)(C)C |
Computed by PubChem (NCBI)