Products 910037-16-0
CAS 910037-16-0 is the registry number for 2-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]benzoic acid, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]benzoic acid (CAS 910037-16-0) is a chemical compound with the molecular formula C12H9F3N2O2 and a molecular weight of 270.21 g/mol. IUPAC name: 2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]benzoic acid. InChIKey: ADEAPHCAMGDLFU-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O2 |
|---|---|
| Molecular weight | 270.21 g/mol |
| IUPAC name | 2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]benzoic acid |
| InChIKey | ADEAPHCAMGDLFU-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(F)(F)F)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)