Products 1370600-86-4

CAS 1370600-86-4 is the registry number for 1-Benzyl-5-(trifluoromethyl)-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

1-benzyl-5-(trifluoromethyl)pyrazole-3-carboxylic acid (CAS 1370600-86-4) is a chemical compound with the molecular formula C12H9F3N2O2 and a molecular weight of 270.21 g/mol. IUPAC name: 1-benzyl-5-(trifluoromethyl)pyrazole-3-carboxylic acid. InChIKey: LHBBRDASVFAZKV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9F3N2O2
Molecular weight270.21 g/mol
IUPAC name1-benzyl-5-(trifluoromethyl)pyrazole-3-carboxylic acid
InChIKeyLHBBRDASVFAZKV-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CN2C(=CC(=N2)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)