CAS 325970-02-3 appears in our catalog under these names: 3-[3-(Trifluoromethyl)phenyl]-1h-pyrazol-1-ylacetic acid, 95%, 2-(3-(3-(Trifluoromethyl)phenyl)-1H-pyrazol-1-yl)acetic acid, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 100mg.
2-[3-[3-(trifluoromethyl)phenyl]pyrazol-1-yl]acetic acid (CAS 325970-02-3) is a chemical compound with the molecular formula C12H9F3N2O2 and a molecular weight of 270.21 g/mol. IUPAC name: 2-[3-[3-(trifluoromethyl)phenyl]pyrazol-1-yl]acetic acid. InChIKey: LPPGGWHLEXOHIJ-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O2 |
|---|---|
| Molecular weight | 270.21 g/mol |
| IUPAC name | 2-[3-[3-(trifluoromethyl)phenyl]pyrazol-1-yl]acetic acid |
| InChIKey | LPPGGWHLEXOHIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=NN(C=C2)CC(=O)O |
Computed by PubChem (NCBI)