cas: 1784130-81-9 — see every product listed under this CAS number, including other names
2-{1-[(tert-butoxy)carbonyl]azetidin-3-yl}-2-cyclopropylacetic acid, 97% (CAS 1784130-81-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch135TCB-100mg |
| cas | 1784130-81-9 |
| size | 100mg |
| availability | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 870.80 Pln | |
| Chemat | 250mg | 1350.80 Pln | |
| Chemat | 500mg | 2214.80 Pln | |
| Chemat | 1g | 3285.20 Pln | |
| Chemat | 5g | 9736.40 Pln | |
| Chemat | 10g | 16182.80 Pln | |
| Fluorochem | 100mg | 1617.16 Pln | |
| Fluorochem | 250mg | 2512.67 Pln | |
| Fluorochem | 500mg | 4100.66 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-cyclopropyl-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]acetic acid (CAS 1784130-81-9) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: 2-cyclopropyl-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]acetic acid. InChIKey: FVPVVLQOJJDDBU-UHFFFAOYSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 2-cyclopropyl-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]acetic acid |
| InChIKey | FVPVVLQOJJDDBU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C(C2CC2)C(=O)O |
Computed by PubChem (NCBI)