cas: 93379-54-5 — see every product listed under this CAS number, including other names
2-{4-[(2S)-2-hydroxy-3-[(propan-2-yl)amino]propoxy]phenyl}acetamide, 98%, 98% (CAS 93379-54-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CMV-1mg |
| cas | 93379-54-5 |
| size | 1mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 414.80 Pln | |
| Chemat | 5mg | 914.00 Pln | |
| Chemat | 25mg | 2171.60 Pln | |
| Chemat | 50mg | 3155.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Esatenolol is the (S)-enantiomer of atenolol. It has a role as a beta-adrenergic antagonist.
Source: ChEBI
| Molecular formula | C14H22N2O3 |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | 2-[4-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetamide |
| InChIKey | METKIMKYRPQLGS-LBPRGKRZSA-N |
| SMILES | CC(C)NC[C@@H](COC1=CC=C(C=C1)CC(=O)N)O |
Computed by PubChem (NCBI)