Products 81346-72-7
CAS 81346-72-7 is the registry number for Atenolol-d6. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-[3-(1,1,1,3,3,3-hexadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]acetamide (CAS 81346-72-7) is a chemical compound with the molecular formula C14H22N2O3 and a molecular weight of 272.37 g/mol. IUPAC name: 2-[4-[3-(1,1,1,3,3,3-hexadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]acetamide. InChIKey: METKIMKYRPQLGS-WFGJKAKNSA-N.
| Molecular formula | C14H22N2O3 |
|---|---|
| Molecular weight | 272.37 g/mol |
| IUPAC name | 2-[4-[3-(1,1,1,3,3,3-hexadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]acetamide |
| InChIKey | METKIMKYRPQLGS-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])NCC(COC1=CC=C(C=C1)CC(=O)N)O |
Computed by PubChem (NCBI)