CAS 1309283-20-2 appears in our catalog under these names: (S)-Atenolol-d7, >95% (HPLC), (S)–Atenolol–d7, (S)-Atenolol-d7. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 50mg, 5mg, 100mg, 50 mg, 5 mg.
2-[4-[(2S)-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]acetamide (CAS 1309283-20-2) is a chemical compound with the molecular formula C14H22N2O3 and a molecular weight of 273.38 g/mol. IUPAC name: 2-[4-[(2S)-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]acetamide. InChIKey: METKIMKYRPQLGS-FAPHKGRVSA-N.
| Molecular formula | C14H22N2O3 |
|---|---|
| Molecular weight | 273.38 g/mol |
| IUPAC name | 2-[4-[(2S)-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]acetamide |
| InChIKey | METKIMKYRPQLGS-FAPHKGRVSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NC[C@@H](COC1=CC=C(C=C1)CC(=O)N)O |
Computed by PubChem (NCBI)