cas: 311310-97-1 — see every product listed under this CAS number, including other names
2-AMINO-6-(METHOXYCARBONYL)BENZOIC ACID HCL, 97% (CAS 311310-97-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387382-100MG |
| cas | 311310-97-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 529.00 Pln | |
| Fluorochem | 10g | 841.39 Pln | |
| Fluorochem | 25g | 1622.36 Pln | |
| Fluorochem | 100g | 4215.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-6-methoxycarbonylbenzoic acid;hydrochloride (CAS 311310-97-1) is a chemical compound with the molecular formula C9H10ClNO4 and a molecular weight of 231.63 g/mol. IUPAC name: 2-amino-6-methoxycarbonylbenzoic acid;hydrochloride. InChIKey: VDKKHVAEYCYZSU-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO4 |
|---|---|
| Molecular weight | 231.63 g/mol |
| IUPAC name | 2-amino-6-methoxycarbonylbenzoic acid;hydrochloride |
| InChIKey | VDKKHVAEYCYZSU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)