cas: 1250997-05-7 — see every product listed under this CAS number, including other names
2-AZABICYCLO[2.2.2]OCTANE-2,6-DICARBOXYLIC ACID 2-TERTBUTYL ESTER, 97% (CAS 1250997-05-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467487-100MG |
| cas | 1250997-05-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 3970.49 Pln | |
| Fluorochem | 250mg | 6297.80 Pln | |
| Fluorochem | 1g | 15622.64 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[2.2.2]octane-6-carboxylic acid (CAS 1250997-05-7) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[2.2.2]octane-6-carboxylic acid. InChIKey: BICQNBQLGTZYCQ-UHFFFAOYSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[2.2.2]octane-6-carboxylic acid |
| InChIKey | BICQNBQLGTZYCQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC1C(C2)C(=O)O |
Computed by PubChem (NCBI)