cas: 134451-94-8 — see every product listed under this CAS number, including other names
2-Acetamido-2-Deoxy-L-Glucopyranose, 98%, 98% (CAS 134451-94-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 100mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110AA3-1mg |
| cas | 134451-94-8 |
| size | 1mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 405.20 Pln | |
| Chemat | 10mg | 866.00 Pln | |
| Chemat | 100mg | 1902.80 Pln | |
| Chemat | 1g | 5085.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-[(2S,3S,4R,5S)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide (CAS 134451-94-8) is a chemical compound with the molecular formula C8H15NO6 and a molecular weight of 221.21 g/mol. IUPAC name: N-[(2S,3S,4R,5S)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide. InChIKey: MBLBDJOUHNCFQT-KVPKETBZSA-N.
| Molecular formula | C8H15NO6 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | N-[(2S,3S,4R,5S)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide |
| InChIKey | MBLBDJOUHNCFQT-KVPKETBZSA-N |
| SMILES | CC(=O)N[C@H](C=O)[C@@H]([C@H]([C@H](CO)O)O)O |
Computed by PubChem (NCBI)