CAS 875654-29-8 is the registry number for N-acetyl-D-talosamine-13C. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
N-[(2S,3R,4R,5R)-3,4,5,6-tetrahydroxy-1-oxo(113C)hexan-2-yl]acetamide (CAS 875654-29-8) is a chemical compound with the molecular formula C8H15NO6 and a molecular weight of 222.20 g/mol. IUPAC name: N-[(2S,3R,4R,5R)-3,4,5,6-tetrahydroxy-1-oxo(113C)hexan-2-yl]acetamide. InChIKey: MBLBDJOUHNCFQT-IUHGHJNCSA-N.
| Molecular formula | C8H15NO6 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | N-[(2S,3R,4R,5R)-3,4,5,6-tetrahydroxy-1-oxo(113C)hexan-2-yl]acetamide |
| InChIKey | MBLBDJOUHNCFQT-IUHGHJNCSA-N |
| SMILES | CC(=O)N[C@H]([13CH]=O)[C@H]([C@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)