2-Acetylanthracene, 97%
cas: 10210-32-9 — see every product listed under this CAS number, including other names
2-Acetylanthracene, 97% (CAS 10210-32-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A649641-250mg |
| cas | 10210-32-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 492.75 Pln | |
| Ambeed | 5g | 1371.62 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 534.80 Pln | |
| Chemat | 5g | 1485.20 Pln | |
| BLDpharm | 250mg | 264.38 Pln | |
| BLDpharm | 1g | 525.40 Pln | |
| BLDpharm | 5g | 1475.06 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-anthracen-2-ylethanone (CAS 10210-32-9) is a chemical compound with the molecular formula C16H12O and a molecular weight of 220.26 g/mol. IUPAC name: 1-anthracen-2-ylethanone. InChIKey: DQFWGPPCMONVDS-UHFFFAOYSA-N.
| Molecular formula | C16H12O |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 1-anthracen-2-ylethanone |
| InChIKey | DQFWGPPCMONVDS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=CC3=CC=CC=C3C=C2C=C1 |
Computed by PubChem (NCBI)
