CAS 30069-65-9 appears in our catalog under these names: 3-Phenylnaphthalen-1-ol, 95%, 3–phenylnaphthalen–1–ol, 3-Phenylnaphthalen-1-ol, 98%, 98%, 3-Phenylnaphthalen-1-ol, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 25g, 5g, 100mg.
3-phenylnaphthalen-1-ol (CAS 30069-65-9) is a chemical compound with the molecular formula C16H12O and a molecular weight of 220.26 g/mol. IUPAC name: 3-phenylnaphthalen-1-ol. InChIKey: MAPYOCUYNJWAJW-UHFFFAOYSA-N.
| Molecular formula | C16H12O |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 3-phenylnaphthalen-1-ol |
| InChIKey | MAPYOCUYNJWAJW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=CC=CC=C3C(=C2)O |
Computed by PubChem (NCBI)