CAS 10210-32-9 appears in our catalog under these names: 2-Acetylanthracene, >95% (HPLC), 2–Acetylanthracene, 2-Acetylanthracene 97%, 2-ACETYLANTHRACENE, 98%, 2-Acetylanthracene, 97%, 97%. Offered by: TRC, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 250mg, 1g, 25g.
1-anthracen-2-ylethanone (CAS 10210-32-9) is a chemical compound with the molecular formula C16H12O and a molecular weight of 220.26 g/mol. IUPAC name: 1-anthracen-2-ylethanone. InChIKey: DQFWGPPCMONVDS-UHFFFAOYSA-N.
| Molecular formula | C16H12O |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 1-anthracen-2-ylethanone |
| InChIKey | DQFWGPPCMONVDS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=CC3=CC=CC=C3C=C2C=C1 |
Computed by PubChem (NCBI)