2-Amino-2-(2,6-difluorophenyl)acetonitrile hydrochloride, 98%
cas: 2703752-43-4 — see every product listed under this CAS number, including other names
2-Amino-2-(2,6-difluorophenyl)acetonitrile hydrochloride, 98% (CAS 2703752-43-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1467436-100mg |
| cas | 2703752-43-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| BLDpharm | 100mg | 214.39 Pln | |
| BLDpharm | 250mg | 303.25 Pln | |
| BLDpharm | 1g | 664.24 Pln | |
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 774.80 Pln | |
| Chemat | 5g | 2915.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-amino-2-(2,6-difluorophenyl)acetonitrile;hydrochloride (CAS 2703752-43-4) is a chemical compound with the molecular formula C8H7ClF2N2 and a molecular weight of 204.60 g/mol. IUPAC name: 2-amino-2-(2,6-difluorophenyl)acetonitrile;hydrochloride. InChIKey: SIGWVDBDFCSUOD-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF2N2 |
|---|---|
| Molecular weight | 204.60 g/mol |
| IUPAC name | 2-amino-2-(2,6-difluorophenyl)acetonitrile;hydrochloride |
| InChIKey | SIGWVDBDFCSUOD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(C#N)N)F.Cl |
Computed by PubChem (NCBI)