CAS 2892551-11-8 is the registry number for 5,7-Difluoro-1H-indol-3-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-difluoro-1H-indol-3-amine;hydrochloride (CAS 2892551-11-8) is a chemical compound with the molecular formula C8H7ClF2N2 and a molecular weight of 204.60 g/mol. IUPAC name: 5,7-difluoro-1H-indol-3-amine;hydrochloride. InChIKey: SRJBNTSWZRPLLN-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF2N2 |
|---|---|
| Molecular weight | 204.60 g/mol |
| IUPAC name | 5,7-difluoro-1H-indol-3-amine;hydrochloride |
| InChIKey | SRJBNTSWZRPLLN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=CN2)N)F)F.Cl |
Computed by PubChem (NCBI)