Products 2703752-43-4
CAS 2703752-43-4 is the registry number for 2-Amino-2-(2,6-difluorophenyl)acetonitrile hydrochloride, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-amino-2-(2,6-difluorophenyl)acetonitrile;hydrochloride (CAS 2703752-43-4) is a chemical compound with the molecular formula C8H7ClF2N2 and a molecular weight of 204.60 g/mol. IUPAC name: 2-amino-2-(2,6-difluorophenyl)acetonitrile;hydrochloride. InChIKey: SIGWVDBDFCSUOD-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF2N2 |
|---|---|
| Molecular weight | 204.60 g/mol |
| IUPAC name | 2-amino-2-(2,6-difluorophenyl)acetonitrile;hydrochloride |
| InChIKey | SIGWVDBDFCSUOD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(C#N)N)F.Cl |
Computed by PubChem (NCBI)