cas: 31932-87-3 — see every product listed under this CAS number, including other names
2-Amino-2-(3-hydroxyphenyl)acetic acid, 98%, 98% (CAS 31932-87-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BYTG-250mg |
| cas | 31932-87-3 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 496.40 Pln | |
| Chemat | 1g | 1043.60 Pln | |
| Chemat | 5g | 3333.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-amino-2-(3-hydroxyphenyl)acetic acid (CAS 31932-87-3) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2-amino-2-(3-hydroxyphenyl)acetic acid. InChIKey: DQLYTFPAEVJTFM-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2-amino-2-(3-hydroxyphenyl)acetic acid |
| InChIKey | DQLYTFPAEVJTFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C(C(=O)O)N |
Computed by PubChem (NCBI)