CAS 51727-05-0 appears in our catalog under these names: 5,6-Dimethyl-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 95%, 5,6–Dimethyl–2–oxo–1,2–dihydropyridine–3–carboxylic acid, 5,6-Dimethyl-2-oxo-1,2-dihydropyridine-3-carboxylic acid 95%, 5,6-Dimethyl-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 98%, 98%, 5,6-Dimethyl-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
5,6-dimethyl-2-oxo-1H-pyridine-3-carboxylic acid (CAS 51727-05-0) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 5,6-dimethyl-2-oxo-1H-pyridine-3-carboxylic acid. InChIKey: RRZTUQQCXRBPRG-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 5,6-dimethyl-2-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | RRZTUQQCXRBPRG-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=O)C(=C1)C(=O)O)C |
Computed by PubChem (NCBI)