CAS 401792-77-6 appears in our catalog under these names: 2-(Methoxycarbonyl)-5-methylpyridin-1-ium-1-olate, 95%, 2-(Methoxycarbonyl)-5-methylpyridine 1-oxide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
Methyl 5-methyl-1-oxidopyridin-1-ium-2-carboxylate (CAS 401792-77-6) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: methyl 5-methyl-1-oxidopyridin-1-ium-2-carboxylate. InChIKey: SPFVTFLCOJWOKZ-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | methyl 5-methyl-1-oxidopyridin-1-ium-2-carboxylate |
| InChIKey | SPFVTFLCOJWOKZ-UHFFFAOYSA-N |
| SMILES | CC1=C[N+](=C(C=C1)C(=O)OC)[O-] |
Computed by PubChem (NCBI)