cas: 51703-58-3 — see every product listed under this CAS number, including other names
2-Amino-2-phenylacetamide hydrochloride, 97% (CAS 51703-58-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F666083-1G |
| cas | 51703-58-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 659.16 Pln | |
| Fluorochem | 5g | 1841.04 Pln | |
| Fluorochem | 10g | 2720.93 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-2-phenylacetamide;hydrochloride (CAS 51703-58-3) is a chemical compound with the molecular formula C8H11ClN2O and a molecular weight of 186.64 g/mol. IUPAC name: 2-amino-2-phenylacetamide;hydrochloride. InChIKey: LXOAFHGMXCFTOU-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O |
|---|---|
| Molecular weight | 186.64 g/mol |
| IUPAC name | 2-amino-2-phenylacetamide;hydrochloride |
| InChIKey | LXOAFHGMXCFTOU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)N)N.Cl |
Computed by PubChem (NCBI)