cas: 20926-15-2 — see every product listed under this CAS number, including other names
2-Amino-3,6-dichlorobenzonitrile, 98%, 98% (CAS 20926-15-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BLHU-100mg |
| cas | 20926-15-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 443.60 Pln | |
| Chemat | 1g | 1019.60 Pln | |
| Chemat | 5g | 3256.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-amino-3,6-dichlorobenzonitrile (CAS 20926-15-2) is a chemical compound with the molecular formula C7H4Cl2N2 and a molecular weight of 187.02 g/mol. IUPAC name: 2-amino-3,6-dichlorobenzonitrile. InChIKey: KEGZPDPJUCCKFA-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2 |
|---|---|
| Molecular weight | 187.02 g/mol |
| IUPAC name | 2-amino-3,6-dichlorobenzonitrile |
| InChIKey | KEGZPDPJUCCKFA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)C#N)N)Cl |
Computed by PubChem (NCBI)