cas: 948014-34-4 — see every product listed under this CAS number, including other names
2-Amino-3-chloro-4-fluoronitrobenzene, 98% (CAS 948014-34-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F237423-5G |
| cas | 948014-34-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 190.58 Pln | |
| Fluorochem | 10g | 320.74 Pln | |
| Fluorochem | 25g | 721.64 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-3-fluoro-6-nitroaniline (CAS 948014-34-4) is a chemical compound with the molecular formula C6H4ClFN2O2 and a molecular weight of 190.56 g/mol. IUPAC name: 2-chloro-3-fluoro-6-nitroaniline. InChIKey: BIYFBTINNKCDBR-UHFFFAOYSA-N.
| Molecular formula | C6H4ClFN2O2 |
|---|---|
| Molecular weight | 190.56 g/mol |
| IUPAC name | 2-chloro-3-fluoro-6-nitroaniline |
| InChIKey | BIYFBTINNKCDBR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])N)Cl)F |
Computed by PubChem (NCBI)