CAS 50409-01-3 is the registry number for 3-Chloro-4,6-difluoro-2-nitroaniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-6-fluoro-2-nitroaniline (CAS 50409-01-3) is a chemical compound with the molecular formula C6H4ClFN2O2 and a molecular weight of 190.56 g/mol. IUPAC name: 3-chloro-6-fluoro-2-nitroaniline. InChIKey: XEFFGBJVAMHUAD-UHFFFAOYSA-N.
| Molecular formula | C6H4ClFN2O2 |
|---|---|
| Molecular weight | 190.56 g/mol |
| IUPAC name | 3-chloro-6-fluoro-2-nitroaniline |
| InChIKey | XEFFGBJVAMHUAD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)N)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)