cas: 187805-54-5 — see every product listed under this CAS number, including other names
2-Amino-3-fluorobenzamide, 98% (CAS 187805-54-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F458717-250MG |
| cas | 187805-54-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 607.10 Pln | |
| Fluorochem | 10g | 1158.98 Pln | |
| Fluorochem | 25g | 2799.03 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-3-fluorobenzamide (CAS 187805-54-5) is a chemical compound with the molecular formula C7H7FN2O and a molecular weight of 154.14 g/mol. IUPAC name: 2-amino-3-fluorobenzamide. InChIKey: LBOUEEMTFKPGKI-UHFFFAOYSA-N.
| Molecular formula | C7H7FN2O |
|---|---|
| Molecular weight | 154.14 g/mol |
| IUPAC name | 2-amino-3-fluorobenzamide |
| InChIKey | LBOUEEMTFKPGKI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)N)C(=O)N |
Computed by PubChem (NCBI)