Products 1379014-43-3

CAS 1379014-43-3 is the registry number for 2-Fluoro-5-methylnicotinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-fluoro-5-methylpyridine-3-carboxamide (CAS 1379014-43-3) is a chemical compound with the molecular formula C7H7FN2O and a molecular weight of 154.14 g/mol. IUPAC name: 2-fluoro-5-methylpyridine-3-carboxamide. InChIKey: MNYGOVXUVPHTEZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7FN2O
Molecular weight154.14 g/mol
IUPAC name2-fluoro-5-methylpyridine-3-carboxamide
InChIKeyMNYGOVXUVPHTEZ-UHFFFAOYSA-N
SMILESCC1=CC(=C(N=C1)F)C(=O)N

Computed by PubChem (NCBI)