CAS 1422554-22-0 appears in our catalog under these names: (Z)-2-Fluoro-n'-hydroxybenzimidamide, 95%, (Z)-2-Fluoro-N'-hydroxybenzene-1-carboximidamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg.
2-fluoro-N'-hydroxybenzenecarboximidamide (CAS 1422554-22-0) is a chemical compound with the molecular formula C7H7FN2O and a molecular weight of 154.14 g/mol. IUPAC name: 2-fluoro-N'-hydroxybenzenecarboximidamide. InChIKey: UQVCPKNHQRKCGJ-UHFFFAOYSA-N.
| Molecular formula | C7H7FN2O |
|---|---|
| Molecular weight | 154.14 g/mol |
| IUPAC name | 2-fluoro-N'-hydroxybenzenecarboximidamide |
| InChIKey | UQVCPKNHQRKCGJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)/C(=N/O)/N)F |
Computed by PubChem (NCBI)